2,5-Bis(trifluoromethyl)aniline is a fluorinated aromatic amine compound used primarily as a pharmaceutical intermediate. Its structure features an aniline core with two trifluoromethyl groups, imparting distinct physicochemical properties such as moderate lipophilicity and low polar surface area.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 328-93-8
Methyl 4-chloroacetoacetate
pharmaceutical intermediate
(4R)-N-(tert-Butyloxycarbonyl)-4-(cyanomethyl)-L-glutamic Acid 1,5-Dimethyl Ester
Pharmaceutical intermediate
Methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate
Pharmaceutical intermediate for antiviral synthesis
2,1,3-benzoxadiazole-4-carbaldehyde
pharmaceutical intermediate
2,5-bis(trifluoromethyl)aniline
XWMVIJUAZAEWIE-UHFFFAOYSA-N
C1=CC(=C(C=C1C(F)(F)F)N)C(F)(F)F