This compound is a research reagent known for its ability to trap reactive metabolites of carcinogens. It features an aromatic ring and halogen substituents, contributing to its reactivity and stability.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 326-06-7
(L)-3-(PROPARGYLSULFENYL)-ALANINE
research compound
Butanedioic acid, 2,3-bis[(4-methylbenzoyl)oxy]-, (2S,3S)-
chiral resolving agent
N-Nitroso Betahistine
nitrosamine reference standard
1-Acetylpyrene
research compound
4,4,4-trifluoro-1-phenylbutane-1,3-dione
VVXLFFIFNVKFBD-UHFFFAOYSA-N
C1=CC=C(C=C1)C(=O)CC(=O)C(F)(F)F