2,2'-Dipyridyl-d8 is a deuterated form of 2,2'-dipyridyl, where all eight hydrogen atoms on the pyridine rings are replaced by deuterium. It is primarily used as a labeled research compound in analytical and synthetic chemistry studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 32190-42-4
BIS(ADAMANTAN-1-YL)(BUTYL)PHOSPHANE
phosphine ligand for cross-coupling catalysis
H-Asp(ome)-OMe HCl
amino acid ester research compound
Aflatoxin P1
mycotoxin reference standard
5-Methylnicotinic acid
research compound
2,2′-Bipyridin
Intermediate for herbicide diquat
(2,2'-Bipyridine)nickel(II) dibromide
catalyst for organic synthesis
Tris(2,2'-bipyridyl)dichlororuthenium(II) hexahydrate
Research reagent for photochemistry
(2,2'-Bipyridine)diiodonickel
research compound for catalysis
2,3,4,5-tetradeuterio-6-(3,4,5,6-tetradeuterio-2-pyridinyl)pyridine
ROFVEXUMMXZLPA-PGRXLJNUSA-N
[2H]C1=C(C(=NC(=C1[2H])C2=C(C(=C(C(=N2)[2H])[2H])[2H])[2H])[2H])[2H]