2,4-Dichlorobenzotrifluoride is a chemical compound that serves as a pharmaceutical intermediate. It is utilized in the manufacturing of various pharmaceutical products.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 320-60-5
5-Fluoro-2-methyl-1H-indene-3-acetic acid
Pharmaceutical intermediate for anti-inflammatory agents
5-Fluoro-2-methyl-1-[[4-(methylthio)phenyl]methylene]-1H-indene-3-acetic acid
pharmaceutical intermediate
1-benzyl-4-methylpiperidin-3-one
Tofacitinib intermediate
1,2-Cyclohexanedimethanol, (1S,2S)-
pharmaceutical intermediate
2,4-dichloro-1-(trifluoromethyl)benzene
KALSHRGEFLVFHE-UHFFFAOYSA-N
C1=CC(=C(C=C1Cl)Cl)C(F)(F)F