Epitalon is a synthetic tetrapeptide compound used as a pharmaceutical ingredient. It consists of a sequence of amino acids and is primarily employed in research related to peptide-based drug development.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 307297-39-8
Azithromycin B
antibiotic active pharmaceutical ingredient
Hexadecyltrimethylammonium nitrite
Quaternary ammonium surfactant intermediate
Bradykinin potentiator B
ACE inhibitor
8-Chloro-1-methyl-6-phenyl-4H-5lambda(5)-(1,2,4)triazolo(4,3-a)(1,4)benzodiazepin-5-ol
active pharmaceutical ingredient impurity
(4S)-4-[[(2S)-2-aminopropanoyl]amino]-5-[[(2S)-3-carboxy-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-5-oxopentanoic acid
HGHOBRRUMWJWCU-FXQIFTODSA-N
C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)O)N