This compound is a deuterium-labeled research reagent, specifically a hexadeuterated derivative of a dithiol diol. Its primary significance lies in its use as an isotopically labeled compound for analytical and research applications, where the incorporation of deuterium enables tracing and quantification in mass spectrometry studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 302912-05-6
L-Aspartic acid-2,3,3-d3
isotopically labeled research reagent
2-Methylalanine-d6
isotopically labeled research reagent
(13C)-Methane
isotopically labeled research reagent
Dimethylamine-15N hydrochloride
isotopically labeled research reagent
2-AMINO-N-(2-CHLORO-6-METHYLPHENYL)THIAZOLE-5-CARBOXAMIDE
research compound
(Z)-1-(2-((4-(((6-(methoxycarbonyl)-2-oxoindolin-3-ylidene)(phenyl)methyl)amino)phenyl)(methyl)amino)-2-oxoethyl)-4-methylpiperazine 1-oxide
research compound
Intedanib Piperazinyl-N4-oxide
N-oxide metabolite reference standard
2,6-DIHYDROXYBENZOIC ACID
MALDI matrix compound
1,1,2,3,4,4-hexadeuterio-2,3-dideuteriooxy-1,4-bis(deuteriosulfanyl)butane
VHJLVAABSRFDPM-BSSDICLPSA-N
[2H]C([2H])(C([2H])(C([2H])(C([2H])([2H])S[2H])O[2H])O[2H])S[2H]