Tert-butyl 4-iodopiperidine-1-carboxylate is a chemical compound used as a pharmaceutical intermediate, primarily in the synthesis of active pharmaceutical ingredients. It features a piperidine ring with an iodine substituent and a tert-butyl carbamate protecting group, commonly employed in medicinal chemistry research.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 301673-14-3
4-N-Boc-2-hydroxymethylpiperazine
Pharmaceutical intermediate
2,5-Dioxopyrrolidin-1-yl N~2~,N~6~-bis(tert-butoxycarbonyl)-L-lysinate
peptide synthesis reagent
N-Fmoc-(2S,5S)-5-tert-butoxypipecolicacid
Pharmaceutical intermediate
(2S,5R)-5-tert-butoxy-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-2-carboxylic acid
pharmaceutical intermediate for peptide synthesis
tert-butyl 4-iodopiperidine-1-carboxylate
YFWQFKUQVJNPKP-UHFFFAOYSA-N
CC(C)(C)OC(=O)N1CCC(CC1)I