This compound is a diselenide derivative of the amino acid cysteine, characterized by the presence of two amine and two carboxylic acid functional groups. It is primarily used as a research reagent in biochemical studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 29621-88-3
2-Fluoro-4-iodoaniline
research reagent
3,5-Dihydroxybenzyl alcohol
research compound
Sodium 2-(trifluoromethyl)benzoate
organic synthesis intermediate
Methyl[(naphthalen-1-yl)methyl]nitrosoamine
N-nitrosamine reference standard
(2R)-2-amino-3-[[(2R)-2-amino-2-carboxyethyl]diselanyl]propanoic acid
JULROCUWKLNBSN-IMJSIDKUSA-N
C([C@@H](C(=O)O)N)[Se][Se]C[C@@H](C(=O)O)N