Gallic acid-d2 is a deuterium-labeled reference standard of gallic acid, specifically the This compound isotopologue. It is primarily used as an internal standard or tracer in analytical chemistry and research applications requiring quantification or tracking of gallic acid.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 294660-92-7
3-Hydroxyacetaminophen-d3
Deuterium-labeled reference standard
(2R)-2-(methylamino)propanoic acid
research compound
2-(2-methylprop-2-enoylamino)propanoic acid
Research reagent for organic synthesis
2-bromo-5-phenylthiophene
research compound
1,4,8,11-Tetraazacyclotetradecane
crown amine for metal coordination
Gallic acid
antioxidant, tanning agent, dyeing intermediate
2,6-dideuterio-3,4,5-trihydroxybenzoic acid
LNTHITQWFMADLM-QDNHWIQGSA-N
[2H]C1=C(C(=C(C(=C1O)O)O)[2H])C(=O)O