Pachymic acid is a triterpenoid compound that has been reported in Rhodofomitopsis lilacinogilva, Fomitopsis pinicola, and other organisms. It is isolated from the fungus Poria cocos and is known to inhibit phospholipase A2.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 29070-92-6
2-chloro-4,6-diphenylpyrimidine
research compound for chemical synthesis
2,3,6-TRICHLOROPYRIDINE
chemical intermediate for research
2,9-DICHLORO-1,10-PHENANTHROLINE
Research reagent for coordination chemistry
1,2-Diaminobenzene (D4, 98%)
Deuterated internal standard for analytical chemistry
(2R)-2-[(3S,5R,10S,13R,14R,16R,17R)-3-acetyloxy-16-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid
VDYCLYGKCGVBHN-DRCQUEPLSA-N
CC(C)C(=C)CC[C@H]([C@H]1[C@@H](C[C@@]2([C@@]1(CCC3=C2CC[C@@H]4[C@@]3(CC[C@@H](C4(C)C)OC(=O)C)C)C)C)O)C(=O)O