This compound is a carboxylic acid derivative featuring two trifluoromethyl groups on an aromatic ring. It serves as a pharmaceutical intermediate, primarily used in the manufacturing process for the active pharmaceutical ingredient netupitant.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 289686-70-0
L-Methionine ethyl ester hydrochloride
Pharmaceutical intermediate
Fmoc-Gly-OH
Fmoc-protected amino acid for peptide synthesis
(2-Butyl-3-benzofuranyl)(4-ethoxy-3,5-diiodophenyl)methanone
Amiodarone impurity reference standard
3,5-Bis(trifluoromethyl)-alpha,N-dimethylbenzylamine
Pharmaceutical intermediate for research synthesis
2-[3,5-bis(trifluoromethyl)phenyl]-2-methylpropanoic acid
ORLKRFYFNMCQIG-UHFFFAOYSA-N
CC(C)(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)C(=O)O