4-(Dimethylamino)phenylboronic acid is a boronic acid derivative with a dimethylamino group attached to a phenyl ring. Its primary significance is as a research compound used in organic synthesis.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 28611-39-4
5-BROMO-2-CHLOROPYRIDIN-3-OL
research compound
Ethyl 4,4-difluoro-2-[(oxiran-2-yl)methyl]butanoate
research compound
1-Acetyl-3-methyl-2,3-dihydro-1H-imidazol-1-ium chloride
research compound
DAPI dihydrochloride
fluorescent DNA staining reagent
[4-(dimethylamino)phenyl]boronic acid
RIIPFHVHLXPMHQ-UHFFFAOYSA-N
B(C1=CC=C(C=C1)N(C)C)(O)O
—