2-Aminobenzophenone is a chemical compound used primarily as a pharmaceutical intermediate in drug manufacturing. It consists of an aromatic ketone structure with an amino substituent, giving it notable polarity and ring-containing character.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 2835-77-0
4-Amino-2-methylphenol
Pharmaceutical intermediate
2-Chloro-N-(4-chloro-2-(2-fluorobenzoyl)phenyl)acetamide
Pharmaceutical intermediate for synthesis
5-amino-2-methylbenzoic acid
Pharmaceutical intermediate compound
3-Amino-4-methoxybenzoic acid
pharmaceutical intermediate
(2-aminophenyl)-phenylmethanone
MAOBFOXLCJIFLV-UHFFFAOYSA-N
C1=CC=C(C=C1)C(=O)C2=CC=CC=C2N