1H,1H,2H,2H-perfluorooctanesulfonic acid is a perfluoroalkyl sulfonic acid primarily used as a surfactant in industrial applications. Its structure features a partially fluorinated carbon chain and a sulfonic acid head group, conferring surface-active properties.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 27619-97-2
5-Isoquinolinesulfonic acid
sulfonic acid intermediate
Butane-1,4-disulfonic acid
Industrial sulfonic acid reagent
Tris(3,5-di-tert-butyl-4-hydroxybenzyl) isocyanurate
Antioxidant for polymer stabilization
Vinyltrimethoxysilane
Silane coupling agent and surface modifier
Potassium 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanesulphonate
Chrome plating agent
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-sulfonic acid
VIONGDJUYAYOPU-UHFFFAOYSA-N
C(CS(=O)(=O)O)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F