[Hydroxy(tosyloxy)iodo]benzene is a hypervalent iodine compound that serves as an oxidizing reagent in organic synthesis. It is characterized by its aromatic rings and a single iodine atom in a hypervalent state, with a molecular weight of approximately 392 g/mol and moderate lipophilicity.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 27126-76-7
1-Acetoxy-1,2-benziodoxol-3-one
hypervalent iodine oxidizing reagent
[Bis(trifluoracetoxy)iod]benzol
hypervalent iodine oxidizing reagent
3,5-Difluorophenol
Research compound for crystallography studies
2,3-Difluorofumaric acid
research compound
3-[(triphenylmethyl)sulfanyl]propanoic acid
Research reagent for peptide synthesis
FURO[2,3-B]PYRIDINE
research compound
[hydroxy(phenyl)-lambda3-iodanyl] 4-methylbenzenesulfonate
LRIUKPUCKCECPT-UHFFFAOYSA-N
CC1=CC=C(C=C1)S(=O)(=O)OI(C2=CC=CC=C2)O