This compound is a pharmaceutical intermediate, specifically a chlorinated benzothiazepine derivative with a sulfone group. Its structure features two aromatic rings and a heterocyclic ring, contributing to its role in chemical synthesis for pharmaceutical applications.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 26638-53-9
3,11-dichloro-6,11-dihydro-6-methyldibenzo[c,f][1,2]thiazepine 5,5-dioxide
Pharmaceutical intermediate for research
4,4-Dimethyl-1,3-oxazolidin-2-one
pharmaceutical intermediate
N4-Benzoylcytosine
pharmaceutical intermediate for nucleoside synthesis
2-((4-Amino-3-methoxyphenyl)sulphonyl)ethyl hydrogen sulphate
Pharmaceutical intermediate for dye synthesis
3-chloro-6-methyl-5,5-dioxobenzo[c][2,1]benzothiazepin-11-one
RGOFXWXKWORKIP-UHFFFAOYSA-N
CN1C2=CC=CC=C2C(=O)C3=C(S1(=O)=O)C=C(C=C3)Cl