N-Methylphenylalanine is a phenylalanine derivative with a methyl group attached to the alpha-amino function. It is primarily utilized as a research compound in laboratory settings.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 2566-30-5
5'-O-(L-tyrosylsulfamoyl)adenosine
research compound
4,4,5,5-Tetramethyl-2-(naphthalen-2-yl)-1,3,2-dioxaborolane
boronic ester for cross-coupling reactions
(5-chloro-2-fluoro-3-pyridyl)-pentafluoro-sulfane
research reagent
2-Bromoethylamine hydrobromide
research compound
(2S)-2-(methylamino)-3-phenylpropanoic acid
SCIFESDRCALIIM-VIFPVBQESA-N
CN[C@@H](CC1=CC=CC=C1)C(=O)O