3-(Trimethoxysilyl)propyl methacrylate is a silane coupling agent commonly used to improve adhesion between organic polymers and inorganic substrates. Its molecular structure combines a methacrylate group for polymer bonding with trimethoxysilyl groups for surface attachment, making it valuable in adhesive formulations.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 2530-85-0
3-Chloropropyltrimethoxysilane
Coupling agent for filled composites
Sodium O-isobutyl dithiocarbonate
flotation collector agent
Benzyltributylammonium bromide
Phase transfer catalyst
Polyethylenglycol
polymer and surfactant raw material
3-trimethoxysilylpropyl 2-methylprop-2-enoate
XDLMVUHYZWKMMD-UHFFFAOYSA-N
CC(=C)C(=O)OCCC[Si](OC)(OC)OC