This compound is a protected amino acid derivative used as a building block in peptide synthesis. It features both a tert-butoxycarbonyl (Boc) protecting group on the alpha-amino group and a benzyloxycarbonyl (Cbz) protecting group on the side chain, enabling selective deprotection during solid-phase or solution-phase peptide assembly.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 2480-93-5
Boc-Lys(Z)-OH
protected amino acid for peptide synthesis
IN2-(benzyloxycarbonyl)-N6-(tert-butoxycarbonyl)-L-lysine
protected amino acid for peptide synthesis
Dicyclohexylamine (S)-2-(((benzyloxy)carbonyl)amino)-4-((tert-butoxycarbonyl)amino)butanoate
protected amino acid intermediate
Boc-Orn(2-Cl-Z)-OH
Protected amino acid for peptide synthesis
Cbz-D-2,4-Diaminobutyric acid
protected amino acid building block
Cbz-L-Isoleucine dicyclohexylamine salt
protected amino acid building block
(3S)-3-AMINO-4-(TERT-BUTOXY)-4-OXOBUTANOIC ACID
protected amino acid building block
Boc-3-(3-pyridyl)-Ala-OH
protected amino acid building block
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(phenylmethoxycarbonylamino)pentanoic acid
QYYCZJUFHDLLOJ-AWEZNQCLSA-N
CC(C)(C)OC(=O)N[C@@H](CCCNC(=O)OCC1=CC=CC=C1)C(=O)O