This compound is a fluorinated pyrrolidine derivative featuring a benzyl group and a chiral amine center. It is primarily utilized as a research compound for laboratory and synthetic chemistry studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 2468621-38-5
Albendazole EP Impurity H
pharmaceutical reference standard
Isomangiferin
research compound
N-nitroso-rasagiline
Nitrosamine standard for pharmaceutical impurity testing
N-Nitroso Tetrahydrofuroylpiprazine
research compound
(R)-1-Benzyl-4,4-difluoropyrrolidin-3-amine
Pharmaceutical intermediate
(S)-1-Benzyl-4,4-difluoropyrrolidin-3-ol
research compound
(S)-(-)-1-Benzyl-3-pyrrolidinol
pharmaceutical intermediate for drug synthesis
(3S)-(+)-1-Benzyl-3-aminopyrrolidine
Pharmaceutical intermediate for chiral synthesis
(3S)-1-benzyl-4,4-difluoropyrrolidin-3-amine
YHCYPHHQYXAKKZ-JTQLQIEISA-N
C1[C@@H](C(CN1CC2=CC=CC=C2)(F)F)N
—