N-tert-butoxycarbonyl-O5-methyl-L-glutamic acid tert-butyl ester is a protected derivative of glutamic acid used as a building block in peptide synthesis. Its structure includes tert-butoxycarbonyl (Boc) and ester protective groups, making it suitable for selective deprotection steps in research settings.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 24277-38-1
Dimethyl N-(tert-butoxycarbonyl)-L-glutamate
Boc-protected amino acid intermediate
(S)-2-((tert-Butoxycarbonyl)amino)-5-methoxy-5-oxopentanoic acid
Protected amino acid for peptide synthesis
N-(tert-Butoxycarbonyl)-L-glutamic Acid 1-tert-Butyl Ester
pharmaceutical intermediate
(4R)-5-(tert-butoxy)-4-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
peptide synthesis intermediate
2-Bromo-3-thiophenecarboxylic acid
research reagent
Nadide phosphate disodium
biochemical research reagent
2-Pentanone-1,1,1,3,3-d5
Deuterated research reference standard
9H-Fluorene-9-methanol
research compound
1-O-tert-butyl 5-O-methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate
IURKEBKDWQGPJJ-JTQLQIEISA-N
CC(C)(C)OC(=O)[C@H](CCC(=O)OC)NC(=O)OC(C)(C)C