This compound is a pharmaceutical active ingredient featuring a complex structure with an amide linkage, a carboxylic acid group, and a tetrahydro-1,8-naphthyridine ring system. It is primarily supplied as a chemical intermediate or research compound for pharmaceutical development.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 2408065-32-5
N-Benzyl albuterol
active pharmaceutical ingredient
7-Ketoabiraterone acetate
pharmaceutical impurity reference standard
FLUPENTIXOL DIHYDROCHLORIDE
Active pharmaceutical ingredient for schizophrenia
(S)-N4-(4-Fluorophenyl)-7-((tetrahydrofuran-3-yl)oxy)quinazoline-4,6-diamine (Afatinib Impurity)
Afatinib impurity reference standard
(2S)-2-[(4-methyloxane-4-carbonyl)amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid
GELVLHVQVRSFAY-FQEVSTJZSA-N
CC1(CCOCC1)C(=O)N[C@@H](CCCCCCCC2=NC3=C(CCCN3)C=C2)C(=O)O