1,3-Dicyclohexylurea is a chemical compound identified as a degradation product of the chemotherapeutic agent 1-(2-chloroethyl)-3-cyclohexyl-1-nitrosourea. Its molecular structure features two cyclohexyl rings attached to a urea core, giving it a non-aromatic, moderately lipophilic character.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 2387-23-7
1,3-dicyclohexylurea
ADFXKUOMJKEIND-UHFFFAOYSA-N
C1CCC(CC1)NC(=O)NC2CCCCC2