2-Bromo-4-methyl-5-nitropyridine is a brominated pyridine derivative carrying a methyl and a nitro substituent. It is primarily used as a pharmaceutical intermediate in the synthesis of more complex organic compounds.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 23056-47-5
1-(7,8-Dinitro-1,2,4,5-tetrahydro-3H-1,5-methano-3-benzazepin-3-yl)-2,2,2-trifluoroethan-1-one
Varenicline intermediate
(3S,4R)-3-fluoro-1-methyl-piperidin-4-amine;dihydrochloride
pharmaceutical intermediate
Tert-butyl (3R)-4,4-difluoro-3-hydroxy-piperidine-1-carboxylate
Pharmaceutical intermediate
(3R,4S)-3-Fluoro-1-methylpiperidin-4-amine dihydrochloride
Pharmaceutical intermediate
2-bromo-4-methyl-5-nitropyridine
OSYUAHGEDKTDOX-UHFFFAOYSA-N
CC1=CC(=NC=C1[N+](=O)[O-])Br