1-Bromo-3,5-di-tert-butylbenzene is a brominated aromatic compound used as a pharmaceutical intermediate. Its structure features a benzene ring with two tert-butyl groups and one bromine substituent, making it a building block in organic synthesis for drug manufacturing.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 22385-77-9
Dimethyl methoxymethylenemalonate
Pharmaceutical intermediate
Allopurinol Impurity B
allopurinol impurity reference standard
6-FLUORO-1,2,3,4-TETRAHYDROISOQUINOLINE
pharmaceutical intermediate
Tert-butyl 2-(3-aminopropyl)-3-[tert-butyl(dimethyl)silyl]oxypiperidine-1-carboxylate
Pharmaceutical intermediate for synthesis
1-bromo-3,5-ditert-butylbenzene
BUOWTUULDKULFI-UHFFFAOYSA-N
CC(C)(C)C1=CC(=CC(=C1)Br)C(C)(C)C