S-adenosylmethioninamine is the S-adenosyl derivative of methioninamine. It acts as the aminopropyl donor in the biosynthesis of the polyamines spermidine and spermine, and is a metabolite found in organisms such as Escherichia coli, Saccharomyces cerevisiae, and humans.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 22365-13-5
Decarboxylated S-Adenosylmethionine Sulfate Salt
research compound
Methylthioadenosine sulfoxide
research compound
2,5-Cyclohexadiene-1,4-dione-2,3,5,6-d4
deuterated research compound
Mometasone Furoate EP Impurity B
Analytical reference standard impurity
(2S)-N-[(2S)-1-[4-[(6aS)-3-[3-[[(6aS)-2-methoxy-8-(4-methoxyphenyl)-11-oxo-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]propoxy]-2-methoxy-11-oxo-6a,7-dihydropyrrolo[2,1-c][1,4]benzodiazepin-8-yl]anilino]-1-oxopropan-2-yl]-2-[3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoylamino]-3-methylbutanamide
antibody-drug conjugate linker payload
2-Chloro(phenyl-3,4,5,6-d4)-boronic acid
deuterated chemical research reagent
3-aminopropyl-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-methylsulfanium
ZUNBITIXDCPNSD-LSRJEVITSA-N
C[S+](CCCN)C[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)O