This compound is a deuterated form of ethylene glycol, where all four hydrogen atoms on the carbon atoms are replaced with deuterium. It is primarily used as a deuterated solvent or reference standard in nuclear magnetic resonance (NMR) spectroscopy and other analytical applications.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 2219-51-4
Calcium;dibromide;dihydrate
Industrial chemical
3,5-Bis(trifluoromethyl)benzamide
Chemical intermediate for pharmaceutical synthesis
2-Butanone, O,O',O''-(ethenylsilylidyne)trioxime
crosslinking agent for silicone polymers
Phenol, 2,2',2''-(1,3,5-triazine-2,4,6-triyl)tris[5-(hexyloxy)-6-methyl-
UV absorber for plastics
Ethane-1,2-diol;2-hydroxyacetic acid
polyethylene glycol diacid precursor
Ethylenglycol
antifreeze and polyester fiber raw material
(1,1,2,2-2H4)Ethane-1,2-(2H2)diol
deuterated NMR standard
1,1,2,2-tetradeuterioethane-1,2-diol
LYCAIKOWRPUZTN-LNLMKGTHSA-N
[2H]C([2H])(C([2H])([2H])O)O