2-Bromo-5-chlorobenzoic acid is a chemical compound commonly employed as a pharmaceutical intermediate. It features a substituted benzoic acid structure with two halogen atoms, making it useful in the synthesis of active pharmaceutical ingredients.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 21739-93-5
Pregnenolone-16-ene acetate oxime
pharmaceutical intermediate for abiraterone
5-Bromo-2-iodobenzoic acid
Pharmaceutical intermediate
1-(Chloromethyl)-2-(trifluoromethyl)benzene
organic synthesis intermediate
Tert-butyl N-(azetidin-3-yl)carbamate hydrochloride
pharmaceutical intermediate for API synthesis
2-bromo-5-chlorobenzoic acid
RBCPJQQJBAQSOU-UHFFFAOYSA-N
C1=CC(=C(C=C1Cl)C(=O)O)Br