3-Isopropoxybenzeneboronic acid is a boronic acid derivative used as a research compound. It features an aromatic ring, an ether functional group, and two hydroxyl groups capable of hydrogen bonding.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 216485-86-8
4-(7-methoxyquinolin-4-yl)-2-methylphenol
Toll-like receptor 8 antagonist
(2R,6R)-2,6-dimethylpiperazine
research compound
N-HEXANE-D14
Deuterated solvent for analytical chemistry
Succinic acid-d6
Deuterated internal standard for analytical chemistry
(3-propan-2-yloxyphenyl)boronic acid
UKZVUHVNTYDSOP-UHFFFAOYSA-N
B(C1=CC(=CC=C1)OC(C)C)(O)O
—