3-Isopropylbenzeneboronic acid is a research reagent used as a chemical intermediate in organic synthesis. It features an aromatic ring and two hydroxyl groups on the boron atom, making it suitable for cross-coupling reactions.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 216019-28-2
2-bromo-3-nitrothiophene
research compound
Methyl beta-alanyl-L-histidinate
research compound for biochemical studies
6-chloro-1,2,3,4-tetrahydroquinolin-4-one
research compound
(E)-N-(4-(4-amino-3-(5-chloro-3-methylbenzofuran-2-yl)-7-oxo-6,7-dihydro-2H-pyrazolo[3,4-d]pyridazin-2-yl)phenyl)-4-(dimethylamino)but-2-enamide
research compound
(3-propan-2-ylphenyl)boronic acid
QSWLFBMVIGQONC-UHFFFAOYSA-N
B(C1=CC(=CC=C1)C(C)C)(O)O