Methyl 3,5-dimethoxybenzoate is a chemical compound characterized by an aromatic ring bearing ester and ether functional groups. It is primarily significant as an intermediate in the synthesis of other chemical products.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 2150-37-0
3-(2,3-dihydrobenzo[b]furan-5-yl)propanoic acid
Pharmaceutical intermediate
5-Chloro-2-furaldehyde
Pharmaceutical intermediate for synthesis
8-Bromo-6-methylquinazolin-4(3H)-one
pharmaceutical intermediate
4-Aminomethyl-pyrrolidin-3-one-methyloxime 2HCl
Pharmaceutical intermediate building block
methyl 3,5-dimethoxybenzoate
YXUIOVUOFQKWDM-UHFFFAOYSA-N
COC1=CC(=CC(=C1)C(=O)OC)OC