This compound is a spirobifluorene derivative with multiple triarylamine and methoxy substituents, characterized by a high molecular weight and 14 ring systems. It is primarily used as a hole transport material in solar cell research due to its aromatic, amine-containing structure.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 207739-72-8
Manganese(II) Bis(trifluoromethanesulfonyl)imide
lithium-ion battery electrolyte additive
Benzene, 5-[difluoro[(trans,trans)-4'-propyl[1,1'-bicyclohexyl]-4-yl]methoxy]-1,2,3-trifluoro-
liquid crystal intermediate
N-(4-(Naphthalen-2-yl)phenyl)naphthalen-2-amine
electronic material
4-(naphthalen-2-yl)aniline
OLED intermediate chemical
2-N,2-N,2-N',2-N',7-N,7-N,7-N',7-N'-octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine
XDXWNHPWWKGTKO-UHFFFAOYSA-N
COC1=CC=C(C=C1)N(C2=CC=C(C=C2)OC)C3=CC4=C(C=C3)C5=C(C46C7=C(C=CC(=C7)N(C8=CC=C(C=C8)OC)C9=CC=C(C=C9)OC)C1=C6C=C(C=C1)N(C1=CC=C(C=C1)OC)C1=CC=C(C=C1)OC)C=C(C=C5)N(C1=CC=C(C=C1)OC)C1=CC=C(C=C1)OC