This compound is a Boc-protected amino acid intermediate, specifically a derivative of 2-hydroxy-4-aminobutanoic acid with a tert-butoxycarbonyl (Boc) protecting group. It is used as a building block in the synthesis of more complex molecules, primarily in pharmaceutical research and manufacturing.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 207305-60-0
(1R,2R)-2-{[(tert-butoxy)carbonyl]amino}cyclopentane-1-carboxylic acid
Boc-protected amino acid intermediate
2-((tert-Butoxycarbonyl)amino)-5-chlorobenzoic acid
Boc-protected amino acid intermediate
(1R,4R)-4-[[(1,1-dimethylethoxy)carbonyl]amino]-2-cyclopentene-1-carboxylic acid
Boc-protected amino acid intermediate
2-[(1s,4s)-4-{[(tert-butoxy)carbonyl]amino}cyclohexyl]acetic acid
Boc-protected amino acid intermediate
1,8-Bis(dimethylamino)naphthalene
Proton sponge for organic synthesis
4-Bromo-1H-pyrazole
Pharmaceutical intermediate
(S)-1-(2-Chloroacetyl)pyrrolidine-2-carbonitrile
Pharmaceutical intermediate for synthesis
(2S)-2-amino-3-(4-nitrophenyl)propanoic acid;hydrate
Pharmaceutical intermediate for peptide synthesis
(2S)-2-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid
POASMXSJVKADPM-LURJTMIESA-N
CC(C)(C)OC(=O)NCC[C@@H](C(=O)O)O
—