This compound is a peptide-like molecule featuring a pyrrolidine ring and a cyclohexyl group, with multiple functional groups including an acid, amide, amine, ester, and ether. It is primarily used as a research compound in laboratory settings.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 2055735-10-7
8-Bromo-1-chlorodibenzo[b,d]thiophene
Research reagent for synthetic chemistry
MC-Val-Cit-PAB-Auristatin E
antibody-drug conjugate linker payload
MC-Val-Cit-PAB-duocarmycin
antibody drug conjugate linker payload
DCTP
nucleotide triphosphate for DNA synthesis
Lisinopril specified impurity F
pharmaceutical impurity reference standard
(2S)-1-[(2S)-2-[[(2S)-4-cyclohexyl-1-ethoxy-1-oxobutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid
ZARBDUSKHGGCSR-XIRDDKMYSA-N
CCOC(=O)[C@H](CCC1CCCCC1)N[C@@H](C)C(=O)N2CCC[C@H]2C(=O)O