5-Nitronicotinic acid is a research compound featuring a pyridine ring substituted with a carboxylic acid and a nitro group. It is used primarily as a laboratory reagent for chemical synthesis and studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 2047-49-6
Methyl 4-fluoro-2-methoxybenzoate
research compound
3-Acetylphenylboronic acid
Boronic acid research reagent
DI-I-PROPYLPHOSPHINE
organophosphorus research reagent
(R)-[(RUCL(H8-BINAP))2(MU-CL)3][NH2ME2]
asymmetric hydrogenation catalyst
5-nitropyridine-3-carboxylic acid
TZAGBVHIUUFVCJ-UHFFFAOYSA-N
C1=C(C=NC=C1[N+](=O)[O-])C(=O)O