Chlorotri(methyl-d3)silane is a deuterated chlorosilane compound used as a research reagent. Its primary significance lies in serving as a stable isotope-labeled building block for synthetic chemistry and materials science studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 20395-57-7
Adenosine 5'-diphosphate sodium salt
Biochemical research reagent
D-Arginine, N2-((1,1-dimethylethoxy)carbonyl)-, monohydrochloride, monohydrate
Research reagent for peptide synthesis
THIOPHENE-2,5-D2
deuterated research compound
(R)-1-(3-(3-Amino-6-(2-fluoro-5-isopropoxyphenyl)pyrazine-2-carboxamido)pyridin-4-yl)piperidine-3-carboxylic acid
research compound
Chlorotrimethylsilane
Silylating agent and silicone intermediate
chloro-tris(trideuteriomethyl)silane
IJOOHPMOJXWVHK-GQALSZNTSA-N
[2H]C([2H])([2H])[Si](C([2H])([2H])[2H])(C([2H])([2H])[2H])Cl