This compound is a fluorinated pyrrolidine derivative with a tert-butoxycarbonyl (Boc) protecting group and a carboxylic acid moiety. It is a research compound used in laboratory and manufacturing settings.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 203866-13-1
3-Methoxyphenethylamine
Research compound
Methyl 3-phenanthryl ketone
research compound
4-BROMOSTYRENE
research compound for synthesis
5-Chloropentyl acetate
chemical intermediate
(2S,4R)-1-[(tert-butoxy)carbonyl]-4-fluoropyrrolidine-2-carboxylic acid
research compound
(2R,4S)-1-(tert-butoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid
research compound
(2R,4R)-1-(tert-Butoxycarbonyl)-4-fluoropyrrolidine-2-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
(2S,4S)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid
YGWZXQOYEBWUTH-BQBZGAKWSA-N
CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)O)F