This compound is a purine derivative featuring an amino group and a carboxylic acid moiety, used as a pharmaceutical intermediate in chemical synthesis. It serves as a building block for the production of various active pharmaceutical ingredients.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 20128-29-4
3-(6-amino-9h-purin-9-yl)propanoic acid
adenosine monophosphate impurity reference standard
Lithium (S)-2-(3-((2-isopropylthiazol-4-yl)methyl)-3-methylureido)-3-methylbutanoate
pharmaceutical intermediate
3-((Acetamidomethyl)sulfanyl)-N-(((9H-fluoren-9-yl)methoxy)carbonyl)-L-valine
Fmoc-protected amino acid for peptide synthesis
Fmoc-Pen(Trt)-OH
Peptide synthesis building block
Diethyl dichloromalonate
pharmaceutical intermediate
2-(6-aminopurin-9-yl)acetic acid
HHVNWGFYTKKIJO-UHFFFAOYSA-N
C1=NC(=C2C(=N1)N(C=N2)CC(=O)O)N