PQ 401 is a research compound that acts as an antagonist of the insulin-like growth factor 1 receptor (IGF-1R). It is a member of the quinoline chemical class and is used primarily in laboratory studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 196868-63-0
(R)-(+)-2-Methyl-2-propanesulfinamide
chiral auxiliary for asymmetric synthesis
2-methylpyrimidine-4,6-diamine
research compound
2,4-Dichlorophenylacetic acid
research compound
Diethyl azodicarboxylate
Reagent in synthetic organic chemistry
1-(5-chloro-2-methoxyphenyl)-3-(2-methylquinolin-4-yl)urea
YBLWOZUPHDKFOT-UHFFFAOYSA-N
CC1=NC2=CC=CC=C2C(=C1)NC(=O)NC3=C(C=CC(=C3)Cl)OC