4-Bromo-2,3-difluorobenzoic acid is a halogenated aromatic carboxylic acid used as a pharmaceutical intermediate in chemical synthesis. Its structure features a bromine atom and two fluorine substituents on the benzene ring, along with a carboxylic acid group, contributing to its utility in building more complex organic molecules for drug development.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 194804-91-6
4-Fluoro-2-(trifluoromethyl)benzonitrile
pharmaceutical intermediate
Methoxyacetic anhydride
Pharmaceutical intermediate for decitabine
1H-1,2,4-Triazole-1-carboximidamide hydrochloride
Pharmaceutical intermediate for antiviral synthesis
1-amino-N-[6-cyano-5-(trifluoromethyl)-3-pyridyl]cyclobutanecarboxamide
Pharmaceutical intermediate
4-bromo-2,3-difluorobenzoic acid
IRUDFVTZXQTEFN-UHFFFAOYSA-N
C1=CC(=C(C(=C1C(=O)O)F)F)Br