Phenylmethanesulfonyl chloride is a chemical compound used as a pharmaceutical intermediate. It functions primarily as a building block in organic synthesis for the preparation of various pharmaceutical compounds.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1939-99-7
2-Phenyl-2-(2-piperidinyl)acetamid
Pharmaceutical intermediate for methylphenidate synthesis
2-Phenyl-2-(piperidin-2-yl)acetic acid hydrochloride
Pharmaceutical intermediate
Ritalinic acid
pharmaceutical intermediate
Ethyl 2-(6-methyl-2-(p-tolyl)imidazo[1,2-a]pyridin-3-yl)acetate
pharmaceutical intermediate
phenylmethanesulfonyl chloride
OAHKWDDSKCRNFE-UHFFFAOYSA-N
C1=CC=C(C=C1)CS(=O)(=O)Cl