This compound is a research reagent featuring a triazine core with morpholine and difluoromethyl-substituted pyridine moieties. Its significance lies in its use as a laboratory tool for biochemical or pharmacological studies, based on its heterocyclic structure.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1927857-61-1
2-Oxo-3-(3-(trifluoromethoxy)phenyl)propanoic acid
research compound
Borane (B2H6)
research reagent for chemical synthesis
5-Fluoro-2-[4-(4-nitrophenyl)-1-piperazinyl]pyrimidine
research compound
Methyl 1H-indazole-4-carboxylate
research compound
4-(difluoromethyl)-5-[4-[(3S)-3-methylmorpholin-4-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]pyridin-2-amine
SYKBZXMKAPICSO-NSHDSACASA-N
C[C@H]1COCCN1C2=NC(=NC(=N2)N3CCOCC3)C4=CN=C(C=C4C(F)F)N