3-Nitrophenylacetic acid is an organic compound used in organic synthesis and as a herbicidal reagent. It is a derivative of phenylacetic acid containing a nitro group on the aromatic ring, and serves as a key intermediate in the formation of heterocyclic compounds.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1877-73-2
2-[[(2S)-2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetic acid
research compound
P-Bromphenylessigsaure
monocarboxylic acid research reagent
1-Bromooctadecane-d37
deuterated research compound
Acetylcorynoline
reference standard for alkaloid analysis
2-(3-nitrophenyl)acetic acid
WUKHOVCMWXMOOA-UHFFFAOYSA-N
C1=CC(=CC(=C1)[N+](=O)[O-])CC(=O)O