Isoleucine methyl ester hydrochloride is a chemical compound used as a research reagent, typically in laboratory settings for synthetic and biochemical studies. It is the hydrochloride salt form of the methyl ester derivative of the amino acid isoleucine.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 18598-74-8
3-chlorophenylzinc iodide
organometallic reagent for cross-coupling
Fmoc-Ala-Pro-OH
research compound for peptide synthesis
Fmoc-Val-Ser(Psime,Mepro)-OH
building block for peptide synthesis
Fmoc-PNA-C(Bhoc)-OH
Peptide nucleic acid building block
methyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride
GGTBEWGOPAFTTH-GEMLJDPKSA-N
CC[C@H](C)[C@@H](C(=O)OC)N.Cl