2-Methyl-6-nitropyridine is a pyridine derivative with a nitro group and a methyl group on the aromatic ring. It is typically used as a research compound in chemical and pharmaceutical laboratories.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 18368-61-1
4-Methyl-2-nitropyridine
research compound
3-(Trifluoromethyl)phenyl isothiocyanate
research compound
5'-Adenylic acid, monohydrate
Purine ribonucleoside monophosphate research reagent
Thymidine 5'-triphosphate sodium salt
nucleotide triphosphate research reagent
2-methyl-6-nitropyridine
DEEYZLKYZZUQPC-UHFFFAOYSA-N
CC1=NC(=CC=C1)[N+](=O)[O-]