Bmdp hydrochloride is a research compound that serves as a cathinone analog. It is supplied as a laboratory reagent for analytical and synthetic chemistry applications.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1823274-68-5
Tert-Butyl 2,4-bis(hydroxymethyl)azetidine-1-carboxylate
research compound
2,4,6-Trifluorophenylboronic acid
Boronic acid reagent for cross-coupling
2-(Trifluoromethoxy)phenyl isocyanate
research compound
Pentanimidamide Hydrochloride
Research compound
1-(1,3-benzodioxol-5-yl)-2-(benzylamino)propan-1-one;hydrochloride
VPHHNGQFGIQHOU-UHFFFAOYSA-N
CC(C(=O)C1=CC2=C(C=C1)OCO2)NCC3=CC=CC=C3.Cl