2,6-Difluorobenzoyl chloride is an aromatic acyl chloride compound featuring a difluorinated benzene ring and a reactive acyl chloride group. It is primarily utilized as a pharmaceutical intermediate in the synthesis of various active pharmaceutical ingredients.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 18063-02-0
Tert-butyl N-[(1S,2S)-2-aminocyclohexyl]carbamate
Boc-protected chiral diamine intermediate
Tert-Butyl 4-bromopiperidine-1-carboxylate
pharmaceutical intermediate
1-(1H-Benzo[d]imidazol-2-yl)-4-(3-methoxypropoxy)-3-methylpyridin-1-ium-2-carboxylate
pharmaceutical intermediate
2-((2S,3S,4R,5R)-5-((S)-2,3-bis(tert-butyldimethylsilyloxy)propyl)-4-methoxy-3-(tosylmethyl)tetrahydrofuran-2-yl)acetaldehyde
Pharmaceutical intermediate for synthesis
2,6-difluorobenzoyl chloride
QRHUZEVERIHEPT-UHFFFAOYSA-N
C1=CC(=C(C(=C1)F)C(=O)Cl)F