6-Chloro-2-methyl-5-nitro-2H-indazole is a chemical compound used as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients. It features a nitro-substituted indazole core with a chlorine atom, contributing to its role in medicinal chemistry research.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1801267-04-8
10-Phenyldecanoic acid
Pharmaceutical research intermediate
(Des-Thr7)-Glucagon Trifluoroacetate
Pharmaceutical intermediate
5-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)-3-methyl-1,3-benzoxazol-2(3H)-one
Pharmaceutical intermediate for drug synthesis
Methyl 2-fluoro-4-(1-methoxy-2-methyl-1-oxopropan-2-ylamino)benzoate
Pharmaceutical intermediate
6-chloro-2-methyl-5-nitroindazole
CHLANRNBFOWJBG-UHFFFAOYSA-N
CN1C=C2C=C(C(=CC2=N1)Cl)[N+](=O)[O-]