1,3-dichloro-2-methoxy-5-nitrobenzene is a chemical compound with a single aromatic ring, two chlorine substituents, a methoxy group, and a nitro group. It is structurally related to the phenethylamine 2C-N, though the provided evidence does not confirm its primary use or specific applications.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 17742-69-7
1,3-dichloro-2-methoxy-5-nitrobenzene
GJYVJKPFYCKNEC-UHFFFAOYSA-N
COC1=C(C=C(C=C1Cl)[N+](=O)[O-])Cl
—