Ethyltriacetoxysilane is an organosilicon compound used primarily as a cross-linking agent in silicone sealants and adhesives. It functions by reacting with moisture to cure silicone formulations, providing durability and adhesion in various applications.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 17689-77-9
4-Chloro-3-nitrobenzenesulfonic acid, sodium salt
chemical intermediate for dyes and pigments
Methanesulfinic acid
organosulfinic acid compound
2-METHYL-2-ADAMANTYL METHACRYLATE
Methacrylate monomer for polymers
2,4-bis(phenylsulfonyl)phenol
Developer for thermal paper
[diacetyloxy(ethyl)silyl] acetate
KXJLGCBCRCSXQF-UHFFFAOYSA-N
CC[Si](OC(=O)C)(OC(=O)C)OC(=O)C